C26H48IN2P — CID 2783737
5-methyl-1,3-dioctyl-5-phenyl-1,3,5-diazaphosphinan-5-ium iodide (PubChem CID 2783737) has the molecular formula C26H48IN2P and a molecular weight of 546.56 g/mol. Its IUPAC name is 5-methyl-1,3-dioctyl-5-phenyl-1,3,5-diazaphosphinan-5-ium iodide.
| Compound Name | 5-methyl-1,3-dioctyl-5-phenyl-1,3,5-diazaphosphinan-5-ium iodide |
|---|---|
| PubChem CID | 2783737 |
| Molecular Formula | C26H48IN2P |
| Molecular Weight | 546.56 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | 5-methyl-1,3-dioctyl-5-phenyl-1,3,5-diazaphosphinan-5-ium iodide |
| SMILES | CCCCCCCCN1CN(CCCCCCCC)C[P+](C)(c2ccccc2)C1.[I-] |
| InChI | InChI=1S/C26H48N2P.HI/c1-4-6-8-10-12-17-21-27-23-28(22-18-13-11-9-7-5-2)25-29(3,24-27)26-19-15-14-16-20-26;/h14-16,19-20H,4-13,17-18,21-25H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | WOEVNDKKEKILOK-UHFFFAOYSA-M |
| XLogP | 4.17 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.56 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|