C29H28N2O2 — CID 27848341
N-methyl-1-(naphthalene-1-carbonyl)-N-(naphthalen-2-ylmethyl)piperidine-4-carboxamide (PubChem CID 27848341) has the molecular formula C29H28N2O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is N-methyl-1-(naphthalene-1-carbonyl)-N-(naphthalen-2-ylmethyl)piperidine-4-carboxamide.
| Compound Name | N-methyl-1-(naphthalene-1-carbonyl)-N-(naphthalen-2-ylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 27848341 |
| Molecular Formula | C29H28N2O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | N-methyl-1-(naphthalene-1-carbonyl)-N-(naphthalen-2-ylmethyl)piperidine-4-carboxamide |
| SMILES | CN(Cc1ccc2ccccc2c1)C(=O)C1CCN(C(=O)c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C29H28N2O2/c1-30(20-21-13-14-22-7-2-3-9-25(22)19-21)28(32)24-15-17-31(18-16-24)29(33)27-12-6-10-23-8-4-5-11-26(23)27/h2-14,19,24H,15-18,20H2,1H3 |
| InChIKey | OLBLICGAOIOLSF-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |