C28H32N2O2 — CID 55430061
N-benzyl-N-butan-2-yl-1-(naphthalene-1-carbonyl)piperidine-4-carboxamide (PubChem CID 55430061) has the molecular formula C28H32N2O2 and a molecular weight of 428.58 g/mol. Its IUPAC name is N-benzyl-N-butan-2-yl-1-(naphthalene-1-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-benzyl-N-butan-2-yl-1-(naphthalene-1-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55430061 |
| Molecular Formula | C28H32N2O2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | N-benzyl-N-butan-2-yl-1-(naphthalene-1-carbonyl)piperidine-4-carboxamide |
| SMILES | CCC(C)N(Cc1ccccc1)C(=O)C1CCN(C(=O)c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C28H32N2O2/c1-3-21(2)30(20-22-10-5-4-6-11-22)27(31)24-16-18-29(19-17-24)28(32)26-15-9-13-23-12-7-8-14-25(23)26/h4-15,21,24H,3,16-20H2,1-2H3 |
| InChIKey | SXOFYXGXHXTUNY-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |