C25H32ClN3O3 — CID 27850757
2-[4-[4-(4-chloro-2-methylphenoxy)butanoyl]piperazin-1-yl]-N-(2,6-dimethylphenyl)acetamide (PubChem CID 27850757) has the molecular formula C25H32ClN3O3 and a molecular weight of 458.00 g/mol. Its IUPAC name is 2-[4-[4-(4-chloro-2-methylphenoxy)butanoyl]piperazin-1-yl]-N-(2,6-dimethylphenyl)acetamide.
| Compound Name | 2-[4-[4-(4-chloro-2-methylphenoxy)butanoyl]piperazin-1-yl]-N-(2,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 27850757 |
| Molecular Formula | C25H32ClN3O3 |
| Molecular Weight | 458.00 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 2-[4-[4-(4-chloro-2-methylphenoxy)butanoyl]piperazin-1-yl]-N-(2,6-dimethylphenyl)acetamide |
| SMILES | Cc1cc(Cl)ccc1OCCCC(=O)N1CCN(CC(=O)Nc2c(C)cccc2C)CC1 |
| InChI | InChI=1S/C25H32ClN3O3/c1-18-6-4-7-19(2)25(18)27-23(30)17-28-11-13-29(14-12-28)24(31)8-5-15-32-22-10-9-21(26)16-20(22)3/h4,6-7,9-10,16H,5,8,11-15,17H2,1-3H3,(H,27,30) |
| InChIKey | LZYJRDQEIMHSGG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.00 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|