C12H14N2O2 — CID 2785431
2-butoxypyrido[1,2-a]pyrimidin-4-one (PubChem CID 2785431) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-butoxypyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-butoxypyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 2785431 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2-butoxypyrido[1,2-a]pyrimidin-4-one |
| SMILES | CCCCOc1cc(=O)n2ccccc2n1 |
| InChI | InChI=1S/C12H14N2O2/c1-2-3-8-16-11-9-12(15)14-7-5-4-6-10(14)13-11/h4-7,9H,2-3,8H2,1H3 |
| InChIKey | KZSKGEJLKNZXTH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|