C10H10Cl2N3O2+ — CID 2785884
5,7-dichloro-1,3,8-trimethylpyrido[2,3-d]pyrimidin-8-ium-2,4-dione (PubChem CID 2785884) has the molecular formula C10H10Cl2N3O2+ and a molecular weight of 275.12 g/mol. Its IUPAC name is 5,7-dichloro-1,3,8-trimethylpyrido[2,3-d]pyrimidin-8-ium-2,4-dione.
| Compound Name | 5,7-dichloro-1,3,8-trimethylpyrido[2,3-d]pyrimidin-8-ium-2,4-dione |
|---|---|
| PubChem CID | 2785884 |
| Molecular Formula | C10H10Cl2N3O2+ |
| Molecular Weight | 275.12 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | 5,7-dichloro-1,3,8-trimethylpyrido[2,3-d]pyrimidin-8-ium-2,4-dione |
| SMILES | Cn1c(=O)c2c(Cl)cc(Cl)[n+](C)c2n(C)c1=O |
| InChI | InChI=1S/C10H10Cl2N3O2/c1-13-6(12)4-5(11)7-8(13)14(2)10(17)15(3)9(7)16/h4H,1-3H3/q+1 |
| InChIKey | BGEPVMVTYZGAPM-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 47.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.12 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|