C43H33N6O2P — CID 2786080
1,3-diphenyl-5-(pyridin-3-ylmethylamino)-7-[(triphenyl-lambda5-phosphanylidene)amino]pyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 2786080) has the molecular formula C43H33N6O2P and a molecular weight of 696.75 g/mol. Its IUPAC name is 1,3-diphenyl-5-(pyridin-3-ylmethylamino)-7-[(triphenyl-lambda5-phosphanylidene)amino]pyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1,3-diphenyl-5-(pyridin-3-ylmethylamino)-7-[(triphenyl-lambda5-phosphanylidene)amino]pyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2786080 |
| Molecular Formula | C43H33N6O2P |
| Molecular Weight | 696.75 g/mol |
| Exact Mass | 696.24 |
| IUPAC Name | 1,3-diphenyl-5-(pyridin-3-ylmethylamino)-7-[(triphenyl-lambda5-phosphanylidene)amino]pyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | O=c1c2c(NCc3cccnc3)cc(N=P(c3ccccc3)(c3ccccc3)c3ccccc3)nc2n(-c2ccccc2)c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C43H33N6O2P/c50-42-40-38(45-31-32-17-16-28-44-30-32)29-39(46-41(40)48(33-18-6-1-7-19-33)43(51)49(42)34-20-8-2-9-21-34)47-52(35-22-10-3-11-23-35,36-24-12-4-13-25-36)37-26-14-5-15-27-37/h1-30H,31H2,(H,45,46) |
| InChIKey | SIRBOVDXQTWNLZ-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.75 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|