C11H7NO4 — CID 2786154
4-methoxychromeno[4,3-c][1,2]oxazol-3-one (PubChem CID 2786154) has the molecular formula C11H7NO4 and a molecular weight of 217.18 g/mol. Its IUPAC name is 4-methoxychromeno[4,3-c][1,2]oxazol-3-one.
| Compound Name | 4-methoxychromeno[4,3-c][1,2]oxazol-3-one |
|---|---|
| PubChem CID | 2786154 |
| Molecular Formula | C11H7NO4 |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 4-methoxychromeno[4,3-c][1,2]oxazol-3-one |
| SMILES | COc1oc2ccccc2c2noc(=O)c1-2 |
| InChI | InChI=1S/C11H7NO4/c1-14-11-8-9(12-16-10(8)13)6-4-2-3-5-7(6)15-11/h2-5H,1H3 |
| InChIKey | BRFDSGBZYYTWDP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 65.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |