C25H29N3O5 — CID 27865933
3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]propanamide (PubChem CID 27865933) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]propanamide.
| Compound Name | 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 27865933 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]propanamide |
| SMILES | COc1cc(CNC(=O)CCN2C(=O)NC3(CCCC3)C2=O)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C25H29N3O5/c1-32-21-15-19(9-10-20(21)33-17-18-7-3-2-4-8-18)16-26-22(29)11-14-28-23(30)25(27-24(28)31)12-5-6-13-25/h2-4,7-10,15H,5-6,11-14,16-17H2,1H3,(H,26,29)(H,27,31) |
| InChIKey | QASPHJUIXBBZMR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|