C27H33N3O5 — CID 17406007
2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-N-methylacetamide (PubChem CID 17406007) has the molecular formula C27H33N3O5 and a molecular weight of 479.58 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-N-methylacetamide.
| Compound Name | 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 17406007 |
| Molecular Formula | C27H33N3O5 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-N-methylacetamide |
| SMILES | COc1cc(CN(C)C(=O)CN2C(=O)NC3(CCCCCC3)C2=O)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C27H33N3O5/c1-29(24(31)18-30-25(32)27(28-26(30)33)14-8-3-4-9-15-27)17-21-12-13-22(23(16-21)34-2)35-19-20-10-6-5-7-11-20/h5-7,10-13,16H,3-4,8-9,14-15,17-19H2,1-2H3,(H,28,33) |
| InChIKey | GRQROJRRJDXVKJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|