C20H18ClN3O3 — CID 27868409
4-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(2-chloro-3-pyridinyl)benzamide (PubChem CID 27868409) has the molecular formula C20H18ClN3O3 and a molecular weight of 383.84 g/mol. Its IUPAC name is 4-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(2-chloro-3-pyridinyl)benzamide.
| Compound Name | 4-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(2-chloro-3-pyridinyl)benzamide |
|---|---|
| PubChem CID | 27868409 |
| Molecular Formula | C20H18ClN3O3 |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 4-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(2-chloro-3-pyridinyl)benzamide |
| SMILES | O=C(Nc1cccnc1Cl)c1ccc(N2C(=O)[C@H]3CCCC[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C20H18ClN3O3/c21-17-16(6-3-11-22-17)23-18(25)12-7-9-13(10-8-12)24-19(26)14-4-1-2-5-15(14)20(24)27/h3,6-11,14-15H,1-2,4-5H2,(H,23,25)/t14-,15-/m0/s1 |
| InChIKey | ZVSXGPZFLHYFCX-GJZGRUSLSA-N |
| XLogP | 3.67 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|