C15H30O — CID 27874
5,5-diethyl-2,2,3,3-tetramethylheptan-4-one (PubChem CID 27874) has the molecular formula C15H30O and a molecular weight of 226.40 g/mol. Its IUPAC name is 5,5-diethyl-2,2,3,3-tetramethylheptan-4-one.
| Compound Name | 5,5-diethyl-2,2,3,3-tetramethylheptan-4-one |
|---|---|
| PubChem CID | 27874 |
| Molecular Formula | C15H30O |
| Molecular Weight | 226.40 g/mol |
| Exact Mass | 226.23 |
| IUPAC Name | 5,5-diethyl-2,2,3,3-tetramethylheptan-4-one |
| SMILES | CCC(CC)(CC)C(=O)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H30O/c1-9-15(10-2,11-3)12(16)14(7,8)13(4,5)6/h9-11H2,1-8H3 |
| InChIKey | BUAHEEAPBZIWMZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |