C15H16N6O3 — CID 2788406
2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(2-methyl-3-phenylprop-2-enylidene)amino]acetamide (PubChem CID 2788406) has the molecular formula C15H16N6O3 and a molecular weight of 328.33 g/mol. Its IUPAC name is 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(2-methyl-3-phenylprop-2-enylidene)amino]acetamide.
| Compound Name | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(2-methyl-3-phenylprop-2-enylidene)amino]acetamide |
|---|---|
| PubChem CID | 2788406 |
| Molecular Formula | C15H16N6O3 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(2-methyl-3-phenylprop-2-enylidene)amino]acetamide |
| SMILES | CC(C=NNC(=O)CNc1n[nH]c(=O)[nH]c1=O)=Cc1ccccc1 |
| InChI | InChI=1S/C15H16N6O3/c1-10(7-11-5-3-2-4-6-11)8-17-19-12(22)9-16-13-14(23)18-15(24)21-20-13/h2-8H,9H2,1H3,(H,16,20)(H,19,22)(H2,18,21,23,24) |
| InChIKey | ZJKBPYTVPUCBHM-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 132.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|