C7H7CaN4O2+ — CID 27888
calcium 3,7-dimethyl-2-oxopurin-6-olate (PubChem CID 27888) has the molecular formula C7H7CaN4O2+ and a molecular weight of 219.24 g/mol. Its IUPAC name is calcium 3,7-dimethyl-2-oxopurin-6-olate.
| Compound Name | calcium 3,7-dimethyl-2-oxopurin-6-olate |
|---|---|
| PubChem CID | 27888 |
| Molecular Formula | C7H7CaN4O2+ |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | calcium 3,7-dimethyl-2-oxopurin-6-olate |
| SMILES | Cn1cnc2c1c([O-])nc(=O)n2C.[Ca+2] |
| InChI | InChI=1S/C7H8N4O2.Ca/c1-10-3-8-5-4(10)6(12)9-7(13)11(5)2;/h3H,1-2H3,(H,9,12,13);/q;+2/p-1 |
| InChIKey | OXXSBBRVUIKPMA-UHFFFAOYSA-M |
| XLogP | -1.64 |
| TPSA | 75.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |