C24H24ClNO4 — CID 27904067
(3aS,7aR)-2-[5-chloro-2-[2-(3,4-dimethylphenyl)-2-oxoethoxy]phenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 27904067) has the molecular formula C24H24ClNO4 and a molecular weight of 425.91 g/mol. Its IUPAC name is (3aS,7aR)-2-[5-chloro-2-[2-(3,4-dimethylphenyl)-2-oxoethoxy]phenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aS,7aR)-2-[5-chloro-2-[2-(3,4-dimethylphenyl)-2-oxoethoxy]phenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 27904067 |
| Molecular Formula | C24H24ClNO4 |
| Molecular Weight | 425.91 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | (3aS,7aR)-2-[5-chloro-2-[2-(3,4-dimethylphenyl)-2-oxoethoxy]phenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | Cc1ccc(C(=O)COc2ccc(Cl)cc2N2C(=O)[C@H]3CCCC[C@H]3C2=O)cc1C |
| InChI | InChI=1S/C24H24ClNO4/c1-14-7-8-16(11-15(14)2)21(27)13-30-22-10-9-17(25)12-20(22)26-23(28)18-5-3-4-6-19(18)24(26)29/h7-12,18-19H,3-6,13H2,1-2H3/t18-,19+ |
| InChIKey | LMEHFKMJWYTNJD-KDURUIRLSA-N |
| XLogP | 4.90 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.91 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|