C12H4Cl4F2N2O — CID 27906964
3,4,5,6-tetrachloro-N-(3,5-difluorophenyl)pyridine-2-carboxamide (PubChem CID 27906964) has the molecular formula C12H4Cl4F2N2O and a molecular weight of 371.99 g/mol. Its IUPAC name is 3,4,5,6-tetrachloro-N-(3,5-difluorophenyl)pyridine-2-carboxamide.
| Compound Name | 3,4,5,6-tetrachloro-N-(3,5-difluorophenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 27906964 |
| Molecular Formula | C12H4Cl4F2N2O |
| Molecular Weight | 371.99 g/mol |
| Exact Mass | 369.90 |
| IUPAC Name | 3,4,5,6-tetrachloro-N-(3,5-difluorophenyl)pyridine-2-carboxamide |
| SMILES | O=C(Nc1cc(F)cc(F)c1)c1nc(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C12H4Cl4F2N2O/c13-7-8(14)10(20-11(16)9(7)15)12(21)19-6-2-4(17)1-5(18)3-6/h1-3H,(H,19,21) |
| InChIKey | MPXCGIYMJVXNBP-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.99 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|