C14H10Cl4N2O3 — CID 18281458
3,4,5,6-tetrachloro-N-(3,5-dimethoxyphenyl)pyridine-2-carboxamide (PubChem CID 18281458) has the molecular formula C14H10Cl4N2O3 and a molecular weight of 396.06 g/mol. Its IUPAC name is 3,4,5,6-tetrachloro-N-(3,5-dimethoxyphenyl)pyridine-2-carboxamide.
| Compound Name | 3,4,5,6-tetrachloro-N-(3,5-dimethoxyphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 18281458 |
| Molecular Formula | C14H10Cl4N2O3 |
| Molecular Weight | 396.06 g/mol |
| Exact Mass | 393.94 |
| IUPAC Name | 3,4,5,6-tetrachloro-N-(3,5-dimethoxyphenyl)pyridine-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2nc(Cl)c(Cl)c(Cl)c2Cl)cc(OC)c1 |
| InChI | InChI=1S/C14H10Cl4N2O3/c1-22-7-3-6(4-8(5-7)23-2)19-14(21)12-10(16)9(15)11(17)13(18)20-12/h3-5H,1-2H3,(H,19,21) |
| InChIKey | BQZAUZDQQNKJAC-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.06 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|