C18H18N6OS3 — CID 27924506
2-[[5-(furan-2-ylmethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 27924506) has the molecular formula C18H18N6OS3 and a molecular weight of 430.58 g/mol. Its IUPAC name is 2-[[5-(furan-2-ylmethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-[[5-(furan-2-ylmethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 27924506 |
| Molecular Formula | C18H18N6OS3 |
| Molecular Weight | 430.58 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 2-[[5-(furan-2-ylmethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1nc(CSc2nnc(NCc3ccco3)s2)nc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C18H18N6OS3/c19-15-14-11-5-1-2-6-12(11)27-16(14)22-13(21-15)9-26-18-24-23-17(28-18)20-8-10-4-3-7-25-10/h3-4,7H,1-2,5-6,8-9H2,(H,20,23)(H2,19,21,22) |
| InChIKey | RCXWZOABPBGNLT-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 102.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |