C19H17FN6S2 — CID 35422948
2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 35422948) has the molecular formula C19H17FN6S2 and a molecular weight of 412.52 g/mol. Its IUPAC name is 2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 35422948 |
| Molecular Formula | C19H17FN6S2 |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1nc(CSc2n[nH]c(-c3ccccc3F)n2)nc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C19H17FN6S2/c20-12-7-3-1-5-10(12)17-24-19(26-25-17)27-9-14-22-16(21)15-11-6-2-4-8-13(11)28-18(15)23-14/h1,3,5,7H,2,4,6,8-9H2,(H2,21,22,23)(H,24,25,26) |
| InChIKey | IBSMAEPXPLSAJO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |