C14H16N6S2 — CID 17457901
2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 17457901) has the molecular formula C14H16N6S2 and a molecular weight of 332.46 g/mol. Its IUPAC name is 2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 17457901 |
| Molecular Formula | C14H16N6S2 |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1nc(SCc2nc(N)c3c4c(sc3n2)CCCC4)n[nH]1 |
| InChI | InChI=1S/C14H16N6S2/c1-7-16-14(20-19-7)21-6-10-17-12(15)11-8-4-2-3-5-9(8)22-13(11)18-10/h2-6H2,1H3,(H2,15,17,18)(H,16,19,20) |
| InChIKey | QYKUIMSYHBGYPP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |