C20H22N6OS2 — CID 46658234
5-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-amine (PubChem CID 46658234) has the molecular formula C20H22N6OS2 and a molecular weight of 426.57 g/mol. Its IUPAC name is 5-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-amine.
| Compound Name | 5-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-amine |
|---|---|
| PubChem CID | 46658234 |
| Molecular Formula | C20H22N6OS2 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 5-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-amine |
| SMILES | CCn1c(SCc2nc(N)c3c4c(sc3n2)CCCCC4)nnc1-c1ccco1 |
| InChI | InChI=1S/C20H22N6OS2/c1-2-26-18(13-8-6-10-27-13)24-25-20(26)28-11-15-22-17(21)16-12-7-4-3-5-9-14(12)29-19(16)23-15/h6,8,10H,2-5,7,9,11H2,1H3,(H2,21,22,23) |
| InChIKey | CWXNJPKZOBEJKR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 95.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |