C23H24FN7OS2 — CID 27924991
2-[[4-(3-fluorophenyl)-5-morpholin-4-yl-1,2,4-triazol-3-yl]sulfanylmethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 27924991) has the molecular formula C23H24FN7OS2 and a molecular weight of 497.63 g/mol. Its IUPAC name is 2-[[4-(3-fluorophenyl)-5-morpholin-4-yl-1,2,4-triazol-3-yl]sulfanylmethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-[[4-(3-fluorophenyl)-5-morpholin-4-yl-1,2,4-triazol-3-yl]sulfanylmethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 27924991 |
| Molecular Formula | C23H24FN7OS2 |
| Molecular Weight | 497.63 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | 2-[[4-(3-fluorophenyl)-5-morpholin-4-yl-1,2,4-triazol-3-yl]sulfanylmethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1nc(CSc2nnc(N3CCOCC3)n2-c2cccc(F)c2)nc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C23H24FN7OS2/c24-14-4-3-5-15(12-14)31-22(30-8-10-32-11-9-30)28-29-23(31)33-13-18-26-20(25)19-16-6-1-2-7-17(16)34-21(19)27-18/h3-5,12H,1-2,6-11,13H2,(H2,25,26,27) |
| InChIKey | ZXXJQBFMJQJTIV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.63 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |