C21H29N7OS2 — CID 36792544
2-[[4-(2-methylpropyl)-5-morpholin-4-yl-1,2,4-triazol-3-yl]sulfanylmethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 36792544) has the molecular formula C21H29N7OS2 and a molecular weight of 459.65 g/mol. Its IUPAC name is 2-[[4-(2-methylpropyl)-5-morpholin-4-yl-1,2,4-triazol-3-yl]sulfanylmethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-[[4-(2-methylpropyl)-5-morpholin-4-yl-1,2,4-triazol-3-yl]sulfanylmethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 36792544 |
| Molecular Formula | C21H29N7OS2 |
| Molecular Weight | 459.65 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 2-[[4-(2-methylpropyl)-5-morpholin-4-yl-1,2,4-triazol-3-yl]sulfanylmethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | CC(C)Cn1c(SCc2nc(N)c3c4c(sc3n2)CCCC4)nnc1N1CCOCC1 |
| InChI | InChI=1S/C21H29N7OS2/c1-13(2)11-28-20(27-7-9-29-10-8-27)25-26-21(28)30-12-16-23-18(22)17-14-5-3-4-6-15(14)31-19(17)24-16/h13H,3-12H2,1-2H3,(H2,22,23,24) |
| InChIKey | WRMFLWCVTCSDGS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.65 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |