C14H17N7S2 — CID 41477281
5-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-amine (PubChem CID 41477281) has the molecular formula C14H17N7S2 and a molecular weight of 347.47 g/mol. Its IUPAC name is 5-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-amine.
| Compound Name | 5-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-amine |
|---|---|
| PubChem CID | 41477281 |
| Molecular Formula | C14H17N7S2 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 5-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-amine |
| SMILES | Nc1nc(SCc2nc(N)c3c4c(sc3n2)CCCCC4)n[nH]1 |
| InChI | InChI=1S/C14H17N7S2/c15-11-10-7-4-2-1-3-5-8(7)23-12(10)18-9(17-11)6-22-14-19-13(16)20-21-14/h1-6H2,(H2,15,17,18)(H3,16,19,20,21) |
| InChIKey | NIRLATAKTJASLE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |