C17H17N7S2 — CID 24578584
5-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanylmethyl)-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-amine (PubChem CID 24578584) has the molecular formula C17H17N7S2 and a molecular weight of 383.51 g/mol. Its IUPAC name is 5-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanylmethyl)-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-amine.
| Compound Name | 5-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanylmethyl)-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-amine |
|---|---|
| PubChem CID | 24578584 |
| Molecular Formula | C17H17N7S2 |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 5-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanylmethyl)-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-amine |
| SMILES | Nc1nc(CSc2nc3ncccn3n2)nc2sc3c(c12)CCCCC3 |
| InChI | InChI=1S/C17H17N7S2/c18-14-13-10-5-2-1-3-6-11(10)26-15(13)21-12(20-14)9-25-17-22-16-19-7-4-8-24(16)23-17/h4,7-8H,1-3,5-6,9H2,(H2,18,20,21) |
| InChIKey | IXQUXYISCDESLZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |