C18H22N6S2 — CID 18207736
2-[(5-cyclopentyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 18207736) has the molecular formula C18H22N6S2 and a molecular weight of 386.55 g/mol. Its IUPAC name is 2-[(5-cyclopentyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-[(5-cyclopentyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 18207736 |
| Molecular Formula | C18H22N6S2 |
| Molecular Weight | 386.55 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 2-[(5-cyclopentyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1nc(CSc2n[nH]c(C3CCCC3)n2)nc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C18H22N6S2/c19-15-14-11-7-3-4-8-12(11)26-17(14)21-13(20-15)9-25-18-22-16(23-24-18)10-5-1-2-6-10/h10H,1-9H2,(H2,19,20,21)(H,22,23,24) |
| InChIKey | AKXXJOIFDSWXIA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.55 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |