C18H12Cl2N4O5S — CID 2798557
N'-[3,5-dichloro-4-(4-nitrophenoxy)phenyl]sulfonylpyridine-3-carboximidamide (PubChem CID 2798557) has the molecular formula C18H12Cl2N4O5S and a molecular weight of 467.29 g/mol. Its IUPAC name is N'-[3,5-dichloro-4-(4-nitrophenoxy)phenyl]sulfonylpyridine-3-carboximidamide.
| Compound Name | N'-[3,5-dichloro-4-(4-nitrophenoxy)phenyl]sulfonylpyridine-3-carboximidamide |
|---|---|
| PubChem CID | 2798557 |
| Molecular Formula | C18H12Cl2N4O5S |
| Molecular Weight | 467.29 g/mol |
| Exact Mass | 465.99 |
| IUPAC Name | N'-[3,5-dichloro-4-(4-nitrophenoxy)phenyl]sulfonylpyridine-3-carboximidamide |
| SMILES | NC(=NS(=O)(=O)c1cc(Cl)c(Oc2ccc([N+](=O)[O-])cc2)c(Cl)c1)c1cccnc1 |
| InChI | InChI=1S/C18H12Cl2N4O5S/c19-15-8-14(30(27,28)23-18(21)11-2-1-7-22-10-11)9-16(20)17(15)29-13-5-3-12(4-6-13)24(25)26/h1-10H,(H2,21,23) |
| InChIKey | GLGJEMSORSLUBP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 137.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.29 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|