C16H17FN4O2S — CID 2798977
ethyl (E)-2-cyano-3-[[[2-[1-(4-fluorophenyl)ethylidene]hydrazinyl]-methylsulfanylmethylidene]amino]prop-2-enoate (PubChem CID 2798977) has the molecular formula C16H17FN4O2S and a molecular weight of 348.40 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[[[2-[1-(4-fluorophenyl)ethylidene]hydrazinyl]-methylsulfanylmethylidene]amino]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[[[2-[1-(4-fluorophenyl)ethylidene]hydrazinyl]-methylsulfanylmethylidene]amino]prop-2-enoate |
|---|---|
| PubChem CID | 2798977 |
| Molecular Formula | C16H17FN4O2S |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | ethyl (E)-2-cyano-3-[[[2-[1-(4-fluorophenyl)ethylidene]hydrazinyl]-methylsulfanylmethylidene]amino]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/N=C(/NN=C(C)c1ccc(F)cc1)SC |
| InChI | InChI=1S/C16H17FN4O2S/c1-4-23-15(22)13(9-18)10-19-16(24-3)21-20-11(2)12-5-7-14(17)8-6-12/h5-8,10H,4H2,1-3H3,(H,19,21)/b13-10+,20-11? |
| InChIKey | DKMGYNMPFXONTP-MQFSGWNHSA-N |
| XLogP | 2.83 |
| TPSA | 86.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|