C15H16FN3O4 — CID 8812468
ethyl (E)-2-cyano-3-[2-[(2S)-2-(4-fluorophenoxy)propanoyl]hydrazinyl]prop-2-enoate (PubChem CID 8812468) has the molecular formula C15H16FN3O4 and a molecular weight of 321.31 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[2-[(2S)-2-(4-fluorophenoxy)propanoyl]hydrazinyl]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[2-[(2S)-2-(4-fluorophenoxy)propanoyl]hydrazinyl]prop-2-enoate |
|---|---|
| PubChem CID | 8812468 |
| Molecular Formula | C15H16FN3O4 |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | ethyl (E)-2-cyano-3-[2-[(2S)-2-(4-fluorophenoxy)propanoyl]hydrazinyl]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/NNC(=O)[C@H](C)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C15H16FN3O4/c1-3-22-15(21)11(8-17)9-18-19-14(20)10(2)23-13-6-4-12(16)5-7-13/h4-7,9-10,18H,3H2,1-2H3,(H,19,20)/b11-9+/t10-/m0/s1 |
| InChIKey | SVGPOXOLJCKLCC-SPQRFVMMSA-N |
| XLogP | 1.18 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|