C17H21N3O5 — CID 8812117
ethyl (E)-2-cyano-3-[2-[(2R)-2-(4-ethoxyphenoxy)propanoyl]hydrazinyl]prop-2-enoate (PubChem CID 8812117) has the molecular formula C17H21N3O5 and a molecular weight of 347.37 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[2-[(2R)-2-(4-ethoxyphenoxy)propanoyl]hydrazinyl]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[2-[(2R)-2-(4-ethoxyphenoxy)propanoyl]hydrazinyl]prop-2-enoate |
|---|---|
| PubChem CID | 8812117 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | ethyl (E)-2-cyano-3-[2-[(2R)-2-(4-ethoxyphenoxy)propanoyl]hydrazinyl]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/NNC(=O)[C@@H](C)Oc1ccc(OCC)cc1 |
| InChI | InChI=1S/C17H21N3O5/c1-4-23-14-6-8-15(9-7-14)25-12(3)16(21)20-19-11-13(10-18)17(22)24-5-2/h6-9,11-12,19H,4-5H2,1-3H3,(H,20,21)/b13-11+/t12-/m1/s1 |
| InChIKey | QGALOKYIDGDZKQ-RVROTUBLSA-N |
| XLogP | 1.44 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|