C15H11BrClN3S — CID 2799582
4-(4-bromothiophen-2-yl)-6-(4-chloro-3-methylphenyl)pyrimidin-2-amine (PubChem CID 2799582) has the molecular formula C15H11BrClN3S and a molecular weight of 380.70 g/mol. Its IUPAC name is 4-(4-bromothiophen-2-yl)-6-(4-chloro-3-methylphenyl)pyrimidin-2-amine.
| Compound Name | 4-(4-bromothiophen-2-yl)-6-(4-chloro-3-methylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 2799582 |
| Molecular Formula | C15H11BrClN3S |
| Molecular Weight | 380.70 g/mol |
| Exact Mass | 378.95 |
| IUPAC Name | 4-(4-bromothiophen-2-yl)-6-(4-chloro-3-methylphenyl)pyrimidin-2-amine |
| SMILES | Cc1cc(-c2cc(-c3cc(Br)cs3)nc(N)n2)ccc1Cl |
| InChI | InChI=1S/C15H11BrClN3S/c1-8-4-9(2-3-11(8)17)12-6-13(20-15(18)19-12)14-5-10(16)7-21-14/h2-7H,1H3,(H2,18,19,20) |
| InChIKey | ZIRYNWVPBKLZFD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.70 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |