C20H11Cl2F2NO2 — CID 2800148
[bis(4-fluorophenyl)methylideneamino] 3,4-dichlorobenzoate (PubChem CID 2800148) has the molecular formula C20H11Cl2F2NO2 and a molecular weight of 406.22 g/mol. Its IUPAC name is [bis(4-fluorophenyl)methylideneamino] 3,4-dichlorobenzoate.
| Compound Name | [bis(4-fluorophenyl)methylideneamino] 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 2800148 |
| Molecular Formula | C20H11Cl2F2NO2 |
| Molecular Weight | 406.22 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | [bis(4-fluorophenyl)methylideneamino] 3,4-dichlorobenzoate |
| SMILES | O=C(ON=C(c1ccc(F)cc1)c1ccc(F)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H11Cl2F2NO2/c21-17-10-5-14(11-18(17)22)20(26)27-25-19(12-1-6-15(23)7-2-12)13-3-8-16(24)9-4-13/h1-11H |
| InChIKey | YBTUAKYVYROJDV-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.22 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|