C26H23Cl2NO3 — CID 2803523
[[2-oxo-2-(2,3,4,5,6-pentamethylphenyl)-1-phenylethylidene]amino] 3,4-dichlorobenzoate (PubChem CID 2803523) has the molecular formula C26H23Cl2NO3 and a molecular weight of 468.38 g/mol. Its IUPAC name is [[2-oxo-2-(2,3,4,5,6-pentamethylphenyl)-1-phenylethylidene]amino] 3,4-dichlorobenzoate.
| Compound Name | [[2-oxo-2-(2,3,4,5,6-pentamethylphenyl)-1-phenylethylidene]amino] 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 2803523 |
| Molecular Formula | C26H23Cl2NO3 |
| Molecular Weight | 468.38 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | [[2-oxo-2-(2,3,4,5,6-pentamethylphenyl)-1-phenylethylidene]amino] 3,4-dichlorobenzoate |
| SMILES | Cc1c(C)c(C)c(C(=O)C(=NOC(=O)c2ccc(Cl)c(Cl)c2)c2ccccc2)c(C)c1C |
| InChI | InChI=1S/C26H23Cl2NO3/c1-14-15(2)17(4)23(18(5)16(14)3)25(30)24(19-9-7-6-8-10-19)29-32-26(31)20-11-12-21(27)22(28)13-20/h6-13H,1-5H3 |
| InChIKey | XNTKORIQOMBWKI-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.38 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|