C18H17Cl2NO3 — CID 5373864
ethyl 3-[[(Z)-1-(3,4-dichlorophenyl)ethylideneamino]oxymethyl]benzoate (PubChem CID 5373864) has the molecular formula C18H17Cl2NO3 and a molecular weight of 366.24 g/mol. Its IUPAC name is ethyl 3-[[(Z)-1-(3,4-dichlorophenyl)ethylideneamino]oxymethyl]benzoate.
| Compound Name | ethyl 3-[[(Z)-1-(3,4-dichlorophenyl)ethylideneamino]oxymethyl]benzoate |
|---|---|
| PubChem CID | 5373864 |
| Molecular Formula | C18H17Cl2NO3 |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | ethyl 3-[[(Z)-1-(3,4-dichlorophenyl)ethylideneamino]oxymethyl]benzoate |
| SMILES | CCOC(=O)c1cccc(CO/N=C(/C)c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C18H17Cl2NO3/c1-3-23-18(22)15-6-4-5-13(9-15)11-24-21-12(2)14-7-8-16(19)17(20)10-14/h4-10H,3,11H2,1-2H3/b21-12- |
| InChIKey | DKTRBGUFZTXLFN-MTJSOVHGSA-N |
| XLogP | 5.11 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|