C15H9Cl2F2NO2 — CID 2799898
[1-(3,4-difluorophenyl)ethylideneamino] 3,4-dichlorobenzoate (PubChem CID 2799898) has the molecular formula C15H9Cl2F2NO2 and a molecular weight of 344.14 g/mol. Its IUPAC name is [1-(3,4-difluorophenyl)ethylideneamino] 3,4-dichlorobenzoate.
| Compound Name | [1-(3,4-difluorophenyl)ethylideneamino] 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 2799898 |
| Molecular Formula | C15H9Cl2F2NO2 |
| Molecular Weight | 344.14 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | [1-(3,4-difluorophenyl)ethylideneamino] 3,4-dichlorobenzoate |
| SMILES | CC(=NOC(=O)c1ccc(Cl)c(Cl)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H9Cl2F2NO2/c1-8(9-3-5-13(18)14(19)7-9)20-22-15(21)10-2-4-11(16)12(17)6-10/h2-7H,1H3 |
| InChIKey | KDZYQLAPWFHZFQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.14 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|