C11H9ClN2O2S — CID 2805466
N-(4-chlorophenyl)-2-(4-oxo-1,3-thiazol-2-yl)acetamide (PubChem CID 2805466) has the molecular formula C11H9ClN2O2S and a molecular weight of 268.72 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(4-oxo-1,3-thiazol-2-yl)acetamide.
| Compound Name | N-(4-chlorophenyl)-2-(4-oxo-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 2805466 |
| Molecular Formula | C11H9ClN2O2S |
| Molecular Weight | 268.72 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | N-(4-chlorophenyl)-2-(4-oxo-1,3-thiazol-2-yl)acetamide |
| SMILES | O=C1CSC(CC(=O)Nc2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C11H9ClN2O2S/c12-7-1-3-8(4-2-7)13-9(15)5-11-14-10(16)6-17-11/h1-4H,5-6H2,(H,13,15) |
| InChIKey | LIKJCKXNHXDBAY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.72 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |