C13H13FN2O2S — CID 2808433
1-(3-ethoxythiophen-2-yl)-3-(3-fluorophenyl)urea (PubChem CID 2808433) has the molecular formula C13H13FN2O2S and a molecular weight of 280.32 g/mol. Its IUPAC name is 1-(3-ethoxythiophen-2-yl)-3-(3-fluorophenyl)urea.
| Compound Name | 1-(3-ethoxythiophen-2-yl)-3-(3-fluorophenyl)urea |
|---|---|
| PubChem CID | 2808433 |
| Molecular Formula | C13H13FN2O2S |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 1-(3-ethoxythiophen-2-yl)-3-(3-fluorophenyl)urea |
| SMILES | CCOc1ccsc1NC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C13H13FN2O2S/c1-2-18-11-6-7-19-12(11)16-13(17)15-10-5-3-4-9(14)8-10/h3-8H,2H2,1H3,(H2,15,16,17) |
| InChIKey | IHYQWKWPLLRJCS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |