About N-(1-methyl-4-oxopyrazolo[5,4-d][1,3]thiazin-6-yl)benzamide
N-(1-methyl-4-oxopyrazolo[5,4-d][1,3]thiazin-6-yl)benzamide (PubChem CID 2810067) has the molecular formula C13H10N4O2S
and a molecular weight of 286.32 g/mol. Its IUPAC name is N-(1-methyl-4-oxopyrazolo[5,4-d][1,3]thiazin-6-yl)benzamide.
Molecular Properties
| Compound Name | N-(1-methyl-4-oxopyrazolo[5,4-d][1,3]thiazin-6-yl)benzamide |
| PubChem CID | 2810067 |
| Molecular Formula | C13H10N4O2S |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | N-(1-methyl-4-oxopyrazolo[5,4-d][1,3]thiazin-6-yl)benzamide |
| SMILES | Cn1ncc2c(=O)sc(NC(=O)c3ccccc3)nc21 |
| InChI | InChI=1S/C13H10N4O2S/c1-17-10-9(7-14-17)12(19)20-13(15-10)16-11(18)8-5-3-2-4-6-8/h2-7H,1H3,(H,15,16,18) |
| InChIKey | FFHLQHUMFYNRTA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(1-methyl-4-oxopyrazolo[5,4-d][1,3]thiazin-6-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-methyl-4-oxopyrazolo[5,4-d][1,3]thiazin-6-yl)benzamide?
The IUPAC name of N-(1-methyl-4-oxopyrazolo[5,4-d][1,3]thiazin-6-yl)benzamide (CID 2810067) is N-(1-methyl-4-oxopyrazolo[5,4-d][1,3]thiazin-6-yl)benzamide.
What is the SMILES notation for N-(1-methyl-4-oxopyrazolo[5,4-d][1,3]thiazin-6-yl)benzamide?
The canonical SMILES for N-(1-methyl-4-oxopyrazolo[5,4-d][1,3]thiazin-6-yl)benzamide is Cn1ncc2c(=O)sc(NC(=O)c3ccccc3)nc21.
What is the InChIKey of N-(1-methyl-4-oxopyrazolo[5,4-d][1,3]thiazin-6-yl)benzamide?
The InChIKey is FFHLQHUMFYNRTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N4O2S/c1-17-10-9(7-14-17)12(19)20-13(15-10)16-11(18)8-5-3-2-4-6-8/h2-7H,1H3,(H,15,16,18).
What are the key properties of N-(1-methyl-4-oxopyrazolo[5,4-d][1,3]thiazin-6-yl)benzamide?
N-(1-methyl-4-oxopyrazolo[5,4-d][1,3]thiazin-6-yl)benzamide has a molecular weight of 286.32 g/mol, XLogP of 1.64, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-methyl-4-oxopyrazolo[5,4-d][1,3]thiazin-6-yl)benzamide is sourced from PubChem (CID 2810067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).