C24H26N2O — CID 2810176
1,4,4,21,21-pentamethyl-11,14-diazapentacyclo[12.7.0.03,11.05,10.015,20]henicosa-2,5,7,9,15,17,19-heptaen-12-one (PubChem CID 2810176) has the molecular formula C24H26N2O and a molecular weight of 358.49 g/mol. Its IUPAC name is 1,4,4,21,21-pentamethyl-11,14-diazapentacyclo[12.7.0.03,11.05,10.015,20]henicosa-2,5,7,9,15,17,19-heptaen-12-one.
| Compound Name | 1,4,4,21,21-pentamethyl-11,14-diazapentacyclo[12.7.0.03,11.05,10.015,20]henicosa-2,5,7,9,15,17,19-heptaen-12-one |
|---|---|
| PubChem CID | 2810176 |
| Molecular Formula | C24H26N2O |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 1,4,4,21,21-pentamethyl-11,14-diazapentacyclo[12.7.0.03,11.05,10.015,20]henicosa-2,5,7,9,15,17,19-heptaen-12-one |
| SMILES | CC1(C)C2=CC3(C)N(CC(=O)N2c2ccccc21)c1ccccc1C3(C)C |
| InChI | InChI=1S/C24H26N2O/c1-22(2)16-10-6-9-13-19(16)26-20(22)14-24(5)23(3,4)17-11-7-8-12-18(17)25(24)15-21(26)27/h6-14H,15H2,1-5H3 |
| InChIKey | ANWQAWSFCDMCDA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |