C16H12ClFN4O3S — CID 2810969
ethyl 1-(3-chloro-4-fluorophenyl)-5-(thiophene-2-carbonylamino)triazole-4-carboxylate (PubChem CID 2810969) has the molecular formula C16H12ClFN4O3S and a molecular weight of 394.82 g/mol. Its IUPAC name is ethyl 1-(3-chloro-4-fluorophenyl)-5-(thiophene-2-carbonylamino)triazole-4-carboxylate.
| Compound Name | ethyl 1-(3-chloro-4-fluorophenyl)-5-(thiophene-2-carbonylamino)triazole-4-carboxylate |
|---|---|
| PubChem CID | 2810969 |
| Molecular Formula | C16H12ClFN4O3S |
| Molecular Weight | 394.82 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | ethyl 1-(3-chloro-4-fluorophenyl)-5-(thiophene-2-carbonylamino)triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(-c2ccc(F)c(Cl)c2)c1NC(=O)c1cccs1 |
| InChI | InChI=1S/C16H12ClFN4O3S/c1-2-25-16(24)13-14(19-15(23)12-4-3-7-26-12)22(21-20-13)9-5-6-11(18)10(17)8-9/h3-8H,2H2,1H3,(H,19,23) |
| InChIKey | VSKGTKQOXJLRAX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.82 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |