C19H17F3N4OS — CID 2813505
N-(1-benzothiophen-3-yl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxamide (PubChem CID 2813505) has the molecular formula C19H17F3N4OS and a molecular weight of 406.43 g/mol. Its IUPAC name is N-(1-benzothiophen-3-yl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxamide.
| Compound Name | N-(1-benzothiophen-3-yl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 2813505 |
| Molecular Formula | C19H17F3N4OS |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | N-(1-benzothiophen-3-yl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxamide |
| SMILES | O=C(Nc1csc2ccccc12)N1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C19H17F3N4OS/c20-19(21,22)13-5-6-17(23-11-13)25-7-9-26(10-8-25)18(27)24-15-12-28-16-4-2-1-3-14(15)16/h1-6,11-12H,7-10H2,(H,24,27) |
| InChIKey | QFKMCHMDDQAVAD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |