C12H15N5OS — CID 2813618
1-[(2,7-dimethylimidazo[1,2-a]pyridine-3-carbonyl)amino]-3-methylthiourea (PubChem CID 2813618) has the molecular formula C12H15N5OS and a molecular weight of 277.35 g/mol. Its IUPAC name is 1-[(2,7-dimethylimidazo[1,2-a]pyridine-3-carbonyl)amino]-3-methylthiourea.
| Compound Name | 1-[(2,7-dimethylimidazo[1,2-a]pyridine-3-carbonyl)amino]-3-methylthiourea |
|---|---|
| PubChem CID | 2813618 |
| Molecular Formula | C12H15N5OS |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 1-[(2,7-dimethylimidazo[1,2-a]pyridine-3-carbonyl)amino]-3-methylthiourea |
| SMILES | CNC(=S)NNC(=O)c1c(C)nc2cc(C)ccn12 |
| InChI | InChI=1S/C12H15N5OS/c1-7-4-5-17-9(6-7)14-8(2)10(17)11(18)15-16-12(19)13-3/h4-6H,1-3H3,(H,15,18)(H2,13,16,19) |
| InChIKey | DCLGSARYBSNVJH-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|