C14H12FN5O — CID 2813777
3-[(4-fluorophenyl)methyl]-6-prop-2-enyltriazolo[4,5-d]pyrimidin-7-one (PubChem CID 2813777) has the molecular formula C14H12FN5O and a molecular weight of 285.28 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-6-prop-2-enyltriazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 3-[(4-fluorophenyl)methyl]-6-prop-2-enyltriazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 2813777 |
| Molecular Formula | C14H12FN5O |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-6-prop-2-enyltriazolo[4,5-d]pyrimidin-7-one |
| SMILES | C=CCn1cnc2c(nnn2Cc2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C14H12FN5O/c1-2-7-19-9-16-13-12(14(19)21)17-18-20(13)8-10-3-5-11(15)6-4-10/h2-6,9H,1,7-8H2 |
| InChIKey | NEASZVINZBHIAM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|