C21H20N6O3S2 — CID 2816962
N-(2,5-dioxo-4-phenylpiperazin-1-yl)-2-[(4-prop-2-enyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 2816962) has the molecular formula C21H20N6O3S2 and a molecular weight of 468.56 g/mol. Its IUPAC name is N-(2,5-dioxo-4-phenylpiperazin-1-yl)-2-[(4-prop-2-enyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-(2,5-dioxo-4-phenylpiperazin-1-yl)-2-[(4-prop-2-enyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 2816962 |
| Molecular Formula | C21H20N6O3S2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | N-(2,5-dioxo-4-phenylpiperazin-1-yl)-2-[(4-prop-2-enyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)NN2CC(=O)N(c3ccccc3)CC2=O)nnc1-c1cccs1 |
| InChI | InChI=1S/C21H20N6O3S2/c1-2-10-25-20(16-9-6-11-31-16)22-23-21(25)32-14-17(28)24-27-13-18(29)26(12-19(27)30)15-7-4-3-5-8-15/h2-9,11H,1,10,12-14H2,(H,24,28) |
| InChIKey | UPPRINQITVSCMH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|