C28H30N4O6 — CID 2818390
1-benzyl-3-[6-(3-benzyl-2,4,6-trioxo-1,3-diazinan-1-yl)hexyl]-1,3-diazinane-2,4,6-trione (PubChem CID 2818390) has the molecular formula C28H30N4O6 and a molecular weight of 518.57 g/mol. Its IUPAC name is 1-benzyl-3-[6-(3-benzyl-2,4,6-trioxo-1,3-diazinan-1-yl)hexyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-benzyl-3-[6-(3-benzyl-2,4,6-trioxo-1,3-diazinan-1-yl)hexyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 2818390 |
| Molecular Formula | C28H30N4O6 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | 1-benzyl-3-[6-(3-benzyl-2,4,6-trioxo-1,3-diazinan-1-yl)hexyl]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1CC(=O)N(Cc2ccccc2)C(=O)N1CCCCCCN1C(=O)CC(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C28H30N4O6/c33-23-17-25(35)31(19-21-11-5-3-6-12-21)27(37)29(23)15-9-1-2-10-16-30-24(34)18-26(36)32(28(30)38)20-22-13-7-4-8-14-22/h3-8,11-14H,1-2,9-10,15-20H2 |
| InChIKey | LDOAJMMPAQIEEG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 115.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|