C19H24OS — CID 2818669
2-methyl-5-thiophen-2-yl-1-(2,6,6-trimethylcyclohex-2-en-1-yl)penta-1,4-dien-3-one (PubChem CID 2818669) has the molecular formula C19H24OS and a molecular weight of 300.47 g/mol. Its IUPAC name is 2-methyl-5-thiophen-2-yl-1-(2,6,6-trimethylcyclohex-2-en-1-yl)penta-1,4-dien-3-one.
| Compound Name | 2-methyl-5-thiophen-2-yl-1-(2,6,6-trimethylcyclohex-2-en-1-yl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 2818669 |
| Molecular Formula | C19H24OS |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 2-methyl-5-thiophen-2-yl-1-(2,6,6-trimethylcyclohex-2-en-1-yl)penta-1,4-dien-3-one |
| SMILES | CC(=CC1C(C)=CCCC1(C)C)C(=O)C=Cc1cccs1 |
| InChI | InChI=1S/C19H24OS/c1-14-7-5-11-19(3,4)17(14)13-15(2)18(20)10-9-16-8-6-12-21-16/h6-10,12-13,17H,5,11H2,1-4H3 |
| InChIKey | JBPFDMURTIPODJ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|