C11H8F2N4O3 — CID 2819094
N-(2,4-difluorophenyl)-1-methyl-5-nitropyrazole-4-carboxamide (PubChem CID 2819094) has the molecular formula C11H8F2N4O3 and a molecular weight of 282.21 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-1-methyl-5-nitropyrazole-4-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-1-methyl-5-nitropyrazole-4-carboxamide |
|---|---|
| PubChem CID | 2819094 |
| Molecular Formula | C11H8F2N4O3 |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | N-(2,4-difluorophenyl)-1-methyl-5-nitropyrazole-4-carboxamide |
| SMILES | Cn1ncc(C(=O)Nc2ccc(F)cc2F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H8F2N4O3/c1-16-11(17(19)20)7(5-14-16)10(18)15-9-3-2-6(12)4-8(9)13/h2-5H,1H3,(H,15,18) |
| InChIKey | JWMDVJJMHZUHBP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|