About copper diperchlorate
copper diperchlorate (PubChem CID 28211) has the molecular formula Cl2CuO8
and a molecular weight of 262.44 g/mol. Its IUPAC name is copper diperchlorate.
Molecular Properties
| Compound Name | copper diperchlorate |
| PubChem CID | 28211 |
| Molecular Formula | Cl2CuO8 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 260.83 |
| IUPAC Name | copper diperchlorate |
| SMILES | [Cu+2].[O-][Cl+3]([O-])([O-])[O-].[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/2ClHO4.Cu/c2*2-1(3,4)5;/h2*(H,2,3,4,5);/q;;+2/p-2 |
| InChIKey | YRNNKGFMTBWUGL-UHFFFAOYSA-L |
| XLogP | -9.51 |
| TPSA | 184.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | -9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze copper diperchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper diperchlorate?
The IUPAC name of copper diperchlorate (CID 28211) is copper diperchlorate.
What is the SMILES notation for copper diperchlorate?
The canonical SMILES for copper diperchlorate is [Cu+2].[O-][Cl+3]([O-])([O-])[O-].[O-][Cl+3]([O-])([O-])[O-].
What is the InChIKey of copper diperchlorate?
The InChIKey is YRNNKGFMTBWUGL-UHFFFAOYSA-L. The full InChI is InChI=1S/2ClHO4.Cu/c2*2-1(3,4)5;/h2*(H,2,3,4,5);/q;;+2/p-2.
What are the key properties of copper diperchlorate?
copper diperchlorate has a molecular weight of 262.44 g/mol, XLogP of -9.51, 0 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for copper diperchlorate is sourced from PubChem (CID 28211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).