About Cupric diperchlorate tetrahydrate
Cupric diperchlorate tetrahydrate (PubChem CID 86521049) has the molecular formula Cl2CuO8-2
and a molecular weight of 262.44 g/mol.
Molecular Properties
| Compound Name | Cupric diperchlorate tetrahydrate |
| PubChem CID | 86521049 |
| Molecular Formula | Cl2CuO8-2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 260.83 |
| IUPAC Name | — |
| SMILES | [Cu].[O-][Cl+3]([O-])([O-])[O-].[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/2ClHO4.Cu/c2*2-1(3,4)5;/h2*(H,2,3,4,5);/p-2 |
| InChIKey | ATCSVSBBEBQVMO-UHFFFAOYSA-L |
| XLogP | -9.51 |
| TPSA | 184.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | -9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze Cupric diperchlorate tetrahydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Cupric diperchlorate tetrahydrate?
The IUPAC name of Cupric diperchlorate tetrahydrate (CID 86521049) is not available.
What is the SMILES notation for Cupric diperchlorate tetrahydrate?
The canonical SMILES for Cupric diperchlorate tetrahydrate is [Cu].[O-][Cl+3]([O-])([O-])[O-].[O-][Cl+3]([O-])([O-])[O-].
What is the InChIKey of Cupric diperchlorate tetrahydrate?
The InChIKey is ATCSVSBBEBQVMO-UHFFFAOYSA-L. The full InChI is InChI=1S/2ClHO4.Cu/c2*2-1(3,4)5;/h2*(H,2,3,4,5);/p-2.
What are the key properties of Cupric diperchlorate tetrahydrate?
Cupric diperchlorate tetrahydrate has a molecular weight of 262.44 g/mol, XLogP of -9.51, 0 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for Cupric diperchlorate tetrahydrate is sourced from PubChem (CID 86521049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).