C12H13Cl2N3OS2 — CID 2821491
3-[2-(2,4-dichlorophenoxy)ethylsulfanylmethyl]-4-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 2821491) has the molecular formula C12H13Cl2N3OS2 and a molecular weight of 350.30 g/mol. Its IUPAC name is 3-[2-(2,4-dichlorophenoxy)ethylsulfanylmethyl]-4-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[2-(2,4-dichlorophenoxy)ethylsulfanylmethyl]-4-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 2821491 |
| Molecular Formula | C12H13Cl2N3OS2 |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | 3-[2-(2,4-dichlorophenoxy)ethylsulfanylmethyl]-4-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | Cn1c(CSCCOc2ccc(Cl)cc2Cl)n[nH]c1=S |
| InChI | InChI=1S/C12H13Cl2N3OS2/c1-17-11(15-16-12(17)19)7-20-5-4-18-10-3-2-8(13)6-9(10)14/h2-3,6H,4-5,7H2,1H3,(H,16,19) |
| InChIKey | TXTOAIAMMSWLDE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|